C16H19NO4S — CID 22868582
(2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-3-sulfanylidenepyrrolidine-2-carboxylic acid (PubChem CID 22868582) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-3-sulfanylidenepyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-3-sulfanylidenepyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22868582 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-3-sulfanylidenepyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(=S)[C@]1(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO4S/c1-15(2,3)21-14(20)17-10-9-12(22)16(17,13(18)19)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3,(H,18,19)/t16-/m0/s1 |
| InChIKey | MAWFVHKAFYOYFQ-INIZCTEOSA-N |
| XLogP | 2.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|