C20H20BrClFNO2 — CID 166755679
tert-butyl (2S)-4-bromo-5-chloro-6-fluoro-2-methyl-2-phenyl-3H-indole-1-carboxylate (PubChem CID 166755679) has the molecular formula C20H20BrClFNO2 and a molecular weight of 440.74 g/mol. Its IUPAC name is tert-butyl (2S)-4-bromo-5-chloro-6-fluoro-2-methyl-2-phenyl-3H-indole-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-bromo-5-chloro-6-fluoro-2-methyl-2-phenyl-3H-indole-1-carboxylate |
|---|---|
| PubChem CID | 166755679 |
| Molecular Formula | C20H20BrClFNO2 |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | tert-butyl (2S)-4-bromo-5-chloro-6-fluoro-2-methyl-2-phenyl-3H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2cc(F)c(Cl)c(Br)c2C[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C20H20BrClFNO2/c1-19(2,3)26-18(25)24-15-10-14(23)17(22)16(21)13(15)11-20(24,4)12-8-6-5-7-9-12/h5-10H,11H2,1-4H3/t20-/m0/s1 |
| InChIKey | AAZPDCSVMHWJAA-FQEVSTJZSA-N |
| XLogP | 6.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|