C15H10BrClFNO2 — CID 166749242
(2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindole-2-carboxylic acid (PubChem CID 166749242) has the molecular formula C15H10BrClFNO2 and a molecular weight of 370.61 g/mol. Its IUPAC name is (2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindole-2-carboxylic acid.
| Compound Name | (2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 166749242 |
| Molecular Formula | C15H10BrClFNO2 |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | (2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@]1(c2ccccc2)Cc2c(cc(F)c(Cl)c2Br)N1 |
| InChI | InChI=1S/C15H10BrClFNO2/c16-12-9-7-15(14(20)21,8-4-2-1-3-5-8)19-11(9)6-10(18)13(12)17/h1-6,19H,7H2,(H,20,21)/t15-/m0/s1 |
| InChIKey | ZEGAPRAUSCSWPC-HNNXBMFYSA-N |
| XLogP | 4.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|