C23H22ClF2N3O — CID 156855779
2-[(2S)-2-(aminomethyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-3-fluorobenzaldehyde;methanamine (PubChem CID 156855779) has the molecular formula C23H22ClF2N3O and a molecular weight of 429.90 g/mol. Its IUPAC name is 2-[(2S)-2-(aminomethyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-3-fluorobenzaldehyde;methanamine.
| Compound Name | 2-[(2S)-2-(aminomethyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-3-fluorobenzaldehyde;methanamine |
|---|---|
| PubChem CID | 156855779 |
| Molecular Formula | C23H22ClF2N3O |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-[(2S)-2-(aminomethyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-3-fluorobenzaldehyde;methanamine |
| SMILES | CN.NC[C@@]1(c2ccccc2)Cc2c(cc(F)c(Cl)c2-c2c(F)cccc2C=O)N1 |
| InChI | InChI=1S/C22H17ClF2N2O.CH5N/c23-21-17(25)9-18-15(20(21)19-13(11-28)5-4-8-16(19)24)10-22(12-26,27-18)14-6-2-1-3-7-14;1-2/h1-9,11,27H,10,12,26H2;2H2,1H3/t22-;/m1./s1 |
| InChIKey | IVEOERHLNIECQG-VZYDHVRKSA-N |
| XLogP | 4.49 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|