C22H14ClF2N5 — CID 156855765
2-[2-(azidomethyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-3-fluorobenzonitrile (PubChem CID 156855765) has the molecular formula C22H14ClF2N5 and a molecular weight of 421.84 g/mol. Its IUPAC name is 2-[2-(azidomethyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-3-fluorobenzonitrile.
| Compound Name | 2-[2-(azidomethyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 156855765 |
| Molecular Formula | C22H14ClF2N5 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[2-(azidomethyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-3-fluorobenzonitrile |
| SMILES | N#Cc1cccc(F)c1-c1c(Cl)c(F)cc2c1CC(CN=[N+]=[N-])(c1ccccc1)N2 |
| InChI | InChI=1S/C22H14ClF2N5/c23-21-17(25)9-18-15(20(21)19-13(11-26)5-4-8-16(19)24)10-22(29-18,12-28-30-27)14-6-2-1-3-7-14/h1-9,29H,10,12H2 |
| InChIKey | FIASOCBWNCHCKP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|