C29H34ClF2N3O2 — CID 156855994
2-[3-[2-(4-aminobutyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-2-fluoro-4-methylphenoxy]ethanol;ethenamine (PubChem CID 156855994) has the molecular formula C29H34ClF2N3O2 and a molecular weight of 530.06 g/mol. Its IUPAC name is 2-[3-[2-(4-aminobutyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-2-fluoro-4-methylphenoxy]ethanol;ethenamine.
| Compound Name | 2-[3-[2-(4-aminobutyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-2-fluoro-4-methylphenoxy]ethanol;ethenamine |
|---|---|
| PubChem CID | 156855994 |
| Molecular Formula | C29H34ClF2N3O2 |
| Molecular Weight | 530.06 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 2-[3-[2-(4-aminobutyl)-5-chloro-6-fluoro-2-phenyl-1,3-dihydroindol-4-yl]-2-fluoro-4-methylphenoxy]ethanol;ethenamine |
| SMILES | C=CN.Cc1ccc(OCCO)c(F)c1-c1c(Cl)c(F)cc2c1CC(CCCCN)(c1ccccc1)N2 |
| InChI | InChI=1S/C27H29ClF2N2O2.C2H5N/c1-17-9-10-22(34-14-13-33)26(30)23(17)24-19-16-27(11-5-6-12-31,18-7-3-2-4-8-18)32-21(19)15-20(29)25(24)28;1-2-3/h2-4,7-10,15,32-33H,5-6,11-14,16,31H2,1H3;2H,1,3H2 |
| InChIKey | WIVGYVWIEXDWGP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.06 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|