C21H12ClF3O2 — CID 156856244
2-(5-chloro-6-fluoro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3,4-difluorobenzaldehyde (PubChem CID 156856244) has the molecular formula C21H12ClF3O2 and a molecular weight of 388.77 g/mol. Its IUPAC name is 2-(5-chloro-6-fluoro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3,4-difluorobenzaldehyde.
| Compound Name | 2-(5-chloro-6-fluoro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3,4-difluorobenzaldehyde |
|---|---|
| PubChem CID | 156856244 |
| Molecular Formula | C21H12ClF3O2 |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-(5-chloro-6-fluoro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3,4-difluorobenzaldehyde |
| SMILES | O=Cc1ccc(F)c(F)c1-c1c(Cl)c(F)cc2c1CC(c1ccccc1)O2 |
| InChI | InChI=1S/C21H12ClF3O2/c22-20-15(24)9-17-13(8-16(27-17)11-4-2-1-3-5-11)19(20)18-12(10-26)6-7-14(23)21(18)25/h1-7,9-10,16H,8H2 |
| InChIKey | BGIWDOCZMAQSSB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|