C17H13BrClFO5 — CID 156856415
(2R,3S)-4-bromo-5-chloro-6-fluoro-3-(methoxymethoxy)-2-phenyl-3H-1-benzofuran-2-carboxylic acid (PubChem CID 156856415) has the molecular formula C17H13BrClFO5 and a molecular weight of 431.64 g/mol. Its IUPAC name is (2R,3S)-4-bromo-5-chloro-6-fluoro-3-(methoxymethoxy)-2-phenyl-3H-1-benzofuran-2-carboxylic acid.
| Compound Name | (2R,3S)-4-bromo-5-chloro-6-fluoro-3-(methoxymethoxy)-2-phenyl-3H-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 156856415 |
| Molecular Formula | C17H13BrClFO5 |
| Molecular Weight | 431.64 g/mol |
| Exact Mass | 429.96 |
| IUPAC Name | (2R,3S)-4-bromo-5-chloro-6-fluoro-3-(methoxymethoxy)-2-phenyl-3H-1-benzofuran-2-carboxylic acid |
| SMILES | COCO[C@H]1c2c(cc(F)c(Cl)c2Br)O[C@]1(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H13BrClFO5/c1-23-8-24-15-12-11(7-10(20)14(19)13(12)18)25-17(15,16(21)22)9-5-3-2-4-6-9/h2-7,15H,8H2,1H3,(H,21,22)/t15-,17+/m0/s1 |
| InChIKey | YSONPOIHONQJCX-DOTOQJQBSA-N |
| XLogP | 4.28 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|