C24H28BrClFNO4 — CID 156856056
tert-butyl N-[4-[(2S,3S)-4-bromo-5-chloro-6-fluoro-3-methyl-2-phenyl-3H-1-benzofuran-2-yl]-4-hydroxybutyl]carbamate (PubChem CID 156856056) has the molecular formula C24H28BrClFNO4 and a molecular weight of 528.85 g/mol. Its IUPAC name is tert-butyl N-[4-[(2S,3S)-4-bromo-5-chloro-6-fluoro-3-methyl-2-phenyl-3H-1-benzofuran-2-yl]-4-hydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2S,3S)-4-bromo-5-chloro-6-fluoro-3-methyl-2-phenyl-3H-1-benzofuran-2-yl]-4-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 156856056 |
| Molecular Formula | C24H28BrClFNO4 |
| Molecular Weight | 528.85 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | tert-butyl N-[4-[(2S,3S)-4-bromo-5-chloro-6-fluoro-3-methyl-2-phenyl-3H-1-benzofuran-2-yl]-4-hydroxybutyl]carbamate |
| SMILES | C[C@H]1c2c(cc(F)c(Cl)c2Br)O[C@@]1(c1ccccc1)C(O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H28BrClFNO4/c1-14-19-17(13-16(27)21(26)20(19)25)31-24(14,15-9-6-5-7-10-15)18(29)11-8-12-28-22(30)32-23(2,3)4/h5-7,9-10,13-14,18,29H,8,11-12H2,1-4H3,(H,28,30)/t14-,18?,24-/m0/s1 |
| InChIKey | RXRYSVZESHTKNS-SMMJIALLSA-N |
| XLogP | 6.30 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.85 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|