C19H18BrClFNO4 — CID 166749148
[(2S,3R)-4-bromo-5-chloro-6-fluoro-3-(methoxymethyl)-2-phenyl-3H-1-benzofuran-2-yl]methyl-methylcarbamic acid (PubChem CID 166749148) has the molecular formula C19H18BrClFNO4 and a molecular weight of 458.71 g/mol. Its IUPAC name is [(2S,3R)-4-bromo-5-chloro-6-fluoro-3-(methoxymethyl)-2-phenyl-3H-1-benzofuran-2-yl]methyl-methylcarbamic acid.
| Compound Name | [(2S,3R)-4-bromo-5-chloro-6-fluoro-3-(methoxymethyl)-2-phenyl-3H-1-benzofuran-2-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 166749148 |
| Molecular Formula | C19H18BrClFNO4 |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | [(2S,3R)-4-bromo-5-chloro-6-fluoro-3-(methoxymethyl)-2-phenyl-3H-1-benzofuran-2-yl]methyl-methylcarbamic acid |
| SMILES | COC[C@H]1c2c(cc(F)c(Cl)c2Br)O[C@]1(CN(C)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H18BrClFNO4/c1-23(18(24)25)10-19(11-6-4-3-5-7-11)12(9-26-2)15-14(27-19)8-13(22)17(21)16(15)20/h3-8,12H,9-10H2,1-2H3,(H,24,25)/t12-,19+/m0/s1 |
| InChIKey | AMNYTKVLAXIOEA-HXPMCKFVSA-N |
| XLogP | 4.87 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|