C15H12BrClFNO2 — CID 156856084
(2S,3S)-2-(aminomethyl)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-3-ol (PubChem CID 156856084) has the molecular formula C15H12BrClFNO2 and a molecular weight of 372.62 g/mol. Its IUPAC name is (2S,3S)-2-(aminomethyl)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-3-ol.
| Compound Name | (2S,3S)-2-(aminomethyl)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 156856084 |
| Molecular Formula | C15H12BrClFNO2 |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | (2S,3S)-2-(aminomethyl)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-3-ol |
| SMILES | NC[C@]1(c2ccccc2)Oc2cc(F)c(Cl)c(Br)c2[C@@H]1O |
| InChI | InChI=1S/C15H12BrClFNO2/c16-12-11-10(6-9(18)13(12)17)21-15(7-19,14(11)20)8-4-2-1-3-5-8/h1-6,14,20H,7,19H2/t14-,15+/m0/s1 |
| InChIKey | JSKINURENDJOHH-LSDHHAIUSA-N |
| XLogP | 3.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|