C16H9BrClFO2 — CID 156855785
7-bromo-6-chloro-5-fluoro-2a-phenyl-1,7b-dihydrocyclobuta[b][1]benzofuran-2-one (PubChem CID 156855785) has the molecular formula C16H9BrClFO2 and a molecular weight of 367.60 g/mol. Its IUPAC name is 7-bromo-6-chloro-5-fluoro-2a-phenyl-1,7b-dihydrocyclobuta[b][1]benzofuran-2-one.
| Compound Name | 7-bromo-6-chloro-5-fluoro-2a-phenyl-1,7b-dihydrocyclobuta[b][1]benzofuran-2-one |
|---|---|
| PubChem CID | 156855785 |
| Molecular Formula | C16H9BrClFO2 |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 7-bromo-6-chloro-5-fluoro-2a-phenyl-1,7b-dihydrocyclobuta[b][1]benzofuran-2-one |
| SMILES | O=C1CC2c3c(cc(F)c(Cl)c3Br)OC12c1ccccc1 |
| InChI | InChI=1S/C16H9BrClFO2/c17-14-13-9-6-12(20)16(9,8-4-2-1-3-5-8)21-11(13)7-10(19)15(14)18/h1-5,7,9H,6H2 |
| InChIKey | BWKBFABJEFTRAF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|