C16H13BrClFN2O3 — CID 166749047
[(2R,3S)-4-bromo-5-chloro-6-fluoro-3-methyl-2-pyridin-2-yl-3H-1-benzofuran-2-yl]methylcarbamic acid (PubChem CID 166749047) has the molecular formula C16H13BrClFN2O3 and a molecular weight of 415.65 g/mol. Its IUPAC name is [(2R,3S)-4-bromo-5-chloro-6-fluoro-3-methyl-2-pyridin-2-yl-3H-1-benzofuran-2-yl]methylcarbamic acid.
| Compound Name | [(2R,3S)-4-bromo-5-chloro-6-fluoro-3-methyl-2-pyridin-2-yl-3H-1-benzofuran-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 166749047 |
| Molecular Formula | C16H13BrClFN2O3 |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | [(2R,3S)-4-bromo-5-chloro-6-fluoro-3-methyl-2-pyridin-2-yl-3H-1-benzofuran-2-yl]methylcarbamic acid |
| SMILES | C[C@H]1c2c(cc(F)c(Cl)c2Br)O[C@]1(CNC(=O)O)c1ccccn1 |
| InChI | InChI=1S/C16H13BrClFN2O3/c1-8-12-10(6-9(19)14(18)13(12)17)24-16(8,7-21-15(22)23)11-4-2-3-5-20-11/h2-6,8,21H,7H2,1H3,(H,22,23)/t8-,16-/m0/s1 |
| InChIKey | QTMNLASZHJAWID-PWJLMRLQSA-N |
| XLogP | 4.30 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|