C26H32BClFNO6 — CID 156855870
[5-chloro-6-fluoro-3-hydroxy-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-2-yl]methyl N-tert-butylcarbamate (PubChem CID 156855870) has the molecular formula C26H32BClFNO6 and a molecular weight of 519.81 g/mol. Its IUPAC name is [5-chloro-6-fluoro-3-hydroxy-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-2-yl]methyl N-tert-butylcarbamate.
| Compound Name | [5-chloro-6-fluoro-3-hydroxy-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-2-yl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 156855870 |
| Molecular Formula | C26H32BClFNO6 |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | [5-chloro-6-fluoro-3-hydroxy-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-2-yl]methyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCC1(c2ccccc2)Oc2cc(F)c(Cl)c(B3OC(C)(C)C(C)(C)O3)c2C1O |
| InChI | InChI=1S/C26H32BClFNO6/c1-23(2,3)30-22(32)33-14-26(15-11-9-8-10-12-15)21(31)18-17(34-26)13-16(29)20(28)19(18)27-35-24(4,5)25(6,7)36-27/h8-13,21,31H,14H2,1-7H3,(H,30,32) |
| InChIKey | CSTMVXNXJQGIGE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|