C29H37BClFN2O5 — CID 174090096
tert-butyl 8-chloro-7-fluoro-10a-(3-methoxyphenyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate (PubChem CID 174090096) has the molecular formula C29H37BClFN2O5 and a molecular weight of 558.89 g/mol. Its IUPAC name is tert-butyl 8-chloro-7-fluoro-10a-(3-methoxyphenyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate.
| Compound Name | tert-butyl 8-chloro-7-fluoro-10a-(3-methoxyphenyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate |
|---|---|
| PubChem CID | 174090096 |
| Molecular Formula | C29H37BClFN2O5 |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | tert-butyl 8-chloro-7-fluoro-10a-(3-methoxyphenyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate |
| SMILES | COc1cccc(C23Cc4c(cc(F)c(Cl)c4B4OC(C)(C)C(C)(C)O4)N2CCN(C(=O)OC(C)(C)C)C3)c1 |
| InChI | InChI=1S/C29H37BClFN2O5/c1-26(2,3)37-25(35)33-12-13-34-22-15-21(32)24(31)23(30-38-27(4,5)28(6,7)39-30)20(22)16-29(34,17-33)18-10-9-11-19(14-18)36-8/h9-11,14-15H,12-13,16-17H2,1-8H3 |
| InChIKey | LRQNLXKNDQDVHV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|