C38H48ClF2N3O5Si — CID 174090232
tert-butyl 9-[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-6-carbamoyl-2-fluorophenyl]-8-chloro-7-fluoro-10a-phenyl-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate (PubChem CID 174090232) has the molecular formula C38H48ClF2N3O5Si and a molecular weight of 728.35 g/mol. Its IUPAC name is tert-butyl 9-[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-6-carbamoyl-2-fluorophenyl]-8-chloro-7-fluoro-10a-phenyl-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate.
| Compound Name | tert-butyl 9-[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-6-carbamoyl-2-fluorophenyl]-8-chloro-7-fluoro-10a-phenyl-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate |
|---|---|
| PubChem CID | 174090232 |
| Molecular Formula | C38H48ClF2N3O5Si |
| Molecular Weight | 728.35 g/mol |
| Exact Mass | 727.30 |
| IUPAC Name | tert-butyl 9-[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-6-carbamoyl-2-fluorophenyl]-8-chloro-7-fluoro-10a-phenyl-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3cc(F)c(Cl)c(-c4c(C(N)=O)ccc(OCCCO[Si](C)(C)C(C)(C)C)c4F)c3CC2(c2ccccc2)C1 |
| InChI | InChI=1S/C38H48ClF2N3O5Si/c1-36(2,3)49-35(46)43-17-18-44-28-21-27(40)32(39)30(26(28)22-38(44,23-43)24-13-10-9-11-14-24)31-25(34(42)45)15-16-29(33(31)41)47-19-12-20-48-50(7,8)37(4,5)6/h9-11,13-16,21H,12,17-20,22-23H2,1-8H3,(H2,42,45) |
| InChIKey | FDWAJMXHQMIZOK-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.35 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|