C30H43ClF3N3O5Si — CID 174090339
tert-butyl 4-[(3E,5E)-6-[3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-carbamoyl-2-fluorophenyl]-5-chloro-4,6-difluorohexa-1,3,5-trien-2-yl]piperazine-1-carboxylate (PubChem CID 174090339) has the molecular formula C30H43ClF3N3O5Si and a molecular weight of 646.22 g/mol. Its IUPAC name is tert-butyl 4-[(3E,5E)-6-[3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-carbamoyl-2-fluorophenyl]-5-chloro-4,6-difluorohexa-1,3,5-trien-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3E,5E)-6-[3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-carbamoyl-2-fluorophenyl]-5-chloro-4,6-difluorohexa-1,3,5-trien-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174090339 |
| Molecular Formula | C30H43ClF3N3O5Si |
| Molecular Weight | 646.22 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | tert-butyl 4-[(3E,5E)-6-[3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-carbamoyl-2-fluorophenyl]-5-chloro-4,6-difluorohexa-1,3,5-trien-2-yl]piperazine-1-carboxylate |
| SMILES | C=C(/C=C(F)\C(Cl)=C(/F)c1c(C(N)=O)ccc(OCCO[Si](C)(C)C(C)(C)C)c1F)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C30H43ClF3N3O5Si/c1-19(36-12-14-37(15-13-36)28(39)42-29(2,3)4)18-21(32)24(31)26(34)23-20(27(35)38)10-11-22(25(23)33)40-16-17-41-43(8,9)30(5,6)7/h10-11,18H,1,12-17H2,2-9H3,(H2,35,38)/b21-18+,26-24+ |
| InChIKey | VUOOALZTHNMTNE-XCBKGGNPSA-N |
| XLogP | 7.12 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.22 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|