C26H34FN3O5 — CID 143593981
tert-butyl 4-methylpiperazine-1-carboxylate;2-[2-(3-fluoro-4-formylphenyl)ethoxy]benzamide (PubChem CID 143593981) has the molecular formula C26H34FN3O5 and a molecular weight of 487.57 g/mol. Its IUPAC name is tert-butyl 4-methylpiperazine-1-carboxylate;2-[2-(3-fluoro-4-formylphenyl)ethoxy]benzamide.
| Compound Name | tert-butyl 4-methylpiperazine-1-carboxylate;2-[2-(3-fluoro-4-formylphenyl)ethoxy]benzamide |
|---|---|
| PubChem CID | 143593981 |
| Molecular Formula | C26H34FN3O5 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | tert-butyl 4-methylpiperazine-1-carboxylate;2-[2-(3-fluoro-4-formylphenyl)ethoxy]benzamide |
| SMILES | CN1CCN(C(=O)OC(C)(C)C)CC1.NC(=O)c1ccccc1OCCc1ccc(C=O)c(F)c1 |
| InChI | InChI=1S/C16H14FNO3.C10H20N2O2/c17-14-9-11(5-6-12(14)10-19)7-8-21-15-4-2-1-3-13(15)16(18)20;1-10(2,3)14-9(13)12-7-5-11(4)6-8-12/h1-6,9-10H,7-8H2,(H2,18,20);5-8H2,1-4H3 |
| InChIKey | WRILGSWLHZPAND-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|