C22H36N2O6 — CID 171081523
tert-butyl 4-[2-[2-[2-(2-aminophenoxy)ethoxy]ethoxy]ethoxy]piperidine-1-carboxylate (PubChem CID 171081523) has the molecular formula C22H36N2O6 and a molecular weight of 424.54 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[2-(2-aminophenoxy)ethoxy]ethoxy]ethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-[2-(2-aminophenoxy)ethoxy]ethoxy]ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171081523 |
| Molecular Formula | C22H36N2O6 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | tert-butyl 4-[2-[2-[2-(2-aminophenoxy)ethoxy]ethoxy]ethoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCCOCCOCCOc2ccccc2N)CC1 |
| InChI | InChI=1S/C22H36N2O6/c1-22(2,3)30-21(25)24-10-8-18(9-11-24)28-16-14-26-12-13-27-15-17-29-20-7-5-4-6-19(20)23/h4-7,18H,8-17,23H2,1-3H3 |
| InChIKey | MZOBHGIDAVICCF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|