C30H45N3O7 — CID 177176296
tert-butyl 4-[2-[4-[2-[amino(methyl)amino]-5-methoxycarbonyl-3-methylphenoxy]phenoxy]ethoxy]piperidine-1-carboxylate;ethane (PubChem CID 177176296) has the molecular formula C30H45N3O7 and a molecular weight of 559.70 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[2-[amino(methyl)amino]-5-methoxycarbonyl-3-methylphenoxy]phenoxy]ethoxy]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[2-[4-[2-[amino(methyl)amino]-5-methoxycarbonyl-3-methylphenoxy]phenoxy]ethoxy]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 177176296 |
| Molecular Formula | C30H45N3O7 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | tert-butyl 4-[2-[4-[2-[amino(methyl)amino]-5-methoxycarbonyl-3-methylphenoxy]phenoxy]ethoxy]piperidine-1-carboxylate;ethane |
| SMILES | CC.COC(=O)c1cc(C)c(N(C)N)c(Oc2ccc(OCCOC3CCN(C(=O)OC(C)(C)C)CC3)cc2)c1 |
| InChI | InChI=1S/C28H39N3O7.C2H6/c1-19-17-20(26(32)34-6)18-24(25(19)30(5)29)37-23-9-7-21(8-10-23)35-15-16-36-22-11-13-31(14-12-22)27(33)38-28(2,3)4;1-2/h7-10,17-18,22H,11-16,29H2,1-6H3;1-2H3 |
| InChIKey | HBDDBHLZOMVBPL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|