C18H26FNO5 — CID 171083364
tert-butyl 4-[2-(2-fluoro-3-hydroxyphenoxy)ethoxy]piperidine-1-carboxylate (PubChem CID 171083364) has the molecular formula C18H26FNO5 and a molecular weight of 355.41 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-fluoro-3-hydroxyphenoxy)ethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-fluoro-3-hydroxyphenoxy)ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171083364 |
| Molecular Formula | C18H26FNO5 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | tert-butyl 4-[2-(2-fluoro-3-hydroxyphenoxy)ethoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCCOc2cccc(O)c2F)CC1 |
| InChI | InChI=1S/C18H26FNO5/c1-18(2,3)25-17(22)20-9-7-13(8-10-20)23-11-12-24-15-6-4-5-14(21)16(15)19/h4-6,13,21H,7-12H2,1-3H3 |
| InChIKey | KALAGNPMRKUDCC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|