C24H34N2O7 — CID 139579331
tert-butyl 4-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]piperidine-1-carboxylate (PubChem CID 139579331) has the molecular formula C24H34N2O7 and a molecular weight of 462.54 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139579331 |
| Molecular Formula | C24H34N2O7 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | tert-butyl 4-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCCOCCOCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C24H34N2O7/c1-24(2,3)33-23(29)25-10-8-18(9-11-25)32-17-16-31-15-14-30-13-12-26-21(27)19-6-4-5-7-20(19)22(26)28/h4-7,18H,8-17H2,1-3H3 |
| InChIKey | VWKRLGRMACGUAP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|