C29H51N3O4Si — CID 168819617
tert-butyl 4-[3-[(E)-benzylideneamino]oxy-6-[tert-butyl(dimethyl)silyl]oxyhexyl]-1,4-diazepane-1-carboxylate (PubChem CID 168819617) has the molecular formula C29H51N3O4Si and a molecular weight of 533.83 g/mol. Its IUPAC name is tert-butyl 4-[3-[(E)-benzylideneamino]oxy-6-[tert-butyl(dimethyl)silyl]oxyhexyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(E)-benzylideneamino]oxy-6-[tert-butyl(dimethyl)silyl]oxyhexyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 168819617 |
| Molecular Formula | C29H51N3O4Si |
| Molecular Weight | 533.83 g/mol |
| Exact Mass | 533.36 |
| IUPAC Name | tert-butyl 4-[3-[(E)-benzylideneamino]oxy-6-[tert-butyl(dimethyl)silyl]oxyhexyl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(CCC(CCCO[Si](C)(C)C(C)(C)C)O/N=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C29H51N3O4Si/c1-28(2,3)35-27(33)32-19-13-18-31(21-22-32)20-17-26(36-30-24-25-14-10-9-11-15-25)16-12-23-34-37(7,8)29(4,5)6/h9-11,14-15,24,26H,12-13,16-23H2,1-8H3/b30-24+ |
| InChIKey | XHZBTEQEUJLZPY-BGABXYSRSA-N |
| XLogP | 6.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.83 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|