C24H41NO3SSi — CID 58073960
tert-butyl 6-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-7-methyl-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 58073960) has the molecular formula C24H41NO3SSi and a molecular weight of 451.75 g/mol. Its IUPAC name is tert-butyl 6-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-7-methyl-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | tert-butyl 6-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-7-methyl-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 58073960 |
| Molecular Formula | C24H41NO3SSi |
| Molecular Weight | 451.75 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | tert-butyl 6-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-7-methyl-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | Cc1ccc2c(c1SCCO[Si](C)(C)C(C)(C)C)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C24H41NO3SSi/c1-18-10-11-19-12-14-25(22(26)28-23(2,3)4)15-13-20(19)21(18)29-17-16-27-30(8,9)24(5,6)7/h10-11H,12-17H2,1-9H3 |
| InChIKey | XYHYJVYJNWVAEI-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.75 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|