C16H22ClNO2S — CID 59822276
tert-butyl 7-chloro-6-(sulfanylmethyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 59822276) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is tert-butyl 7-chloro-6-(sulfanylmethyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | tert-butyl 7-chloro-6-(sulfanylmethyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 59822276 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | tert-butyl 7-chloro-6-(sulfanylmethyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(Cl)c(CS)c2CC1 |
| InChI | InChI=1S/C16H22ClNO2S/c1-16(2,3)20-15(19)18-8-6-11-4-5-14(17)13(10-21)12(11)7-9-18/h4-5,21H,6-10H2,1-3H3 |
| InChIKey | MJDSGEIEIKPCHN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|