C16H23ClNO2S+ — CID 143422605
[7-chloro-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,2,4,5-tetrahydro-3-benzazepin-6-yl]methylsulfanium (PubChem CID 143422605) has the molecular formula C16H23ClNO2S+ and a molecular weight of 328.89 g/mol. Its IUPAC name is [7-chloro-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,2,4,5-tetrahydro-3-benzazepin-6-yl]methylsulfanium.
| Compound Name | [7-chloro-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,2,4,5-tetrahydro-3-benzazepin-6-yl]methylsulfanium |
|---|---|
| PubChem CID | 143422605 |
| Molecular Formula | C16H23ClNO2S+ |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [7-chloro-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,2,4,5-tetrahydro-3-benzazepin-6-yl]methylsulfanium |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(Cl)c(C[SH2+])c2CC1 |
| InChI | InChI=1S/C16H22ClNO2S/c1-16(2,3)20-15(19)18-8-6-11-4-5-14(17)13(10-21)12(11)7-9-18/h4-5,21H,6-10H2,1-3H3/p+1 |
| InChIKey | MJDSGEIEIKPCHN-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|