C19H25N3O3S — CID 58074031
tert-butyl 6-(dimethylcarbamoylsulfanyl)-7-isocyano-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 58074031) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is tert-butyl 6-(dimethylcarbamoylsulfanyl)-7-isocyano-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | tert-butyl 6-(dimethylcarbamoylsulfanyl)-7-isocyano-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 58074031 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | tert-butyl 6-(dimethylcarbamoylsulfanyl)-7-isocyano-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | [C-]#[N+]c1ccc2c(c1SC(=O)N(C)C)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C19H25N3O3S/c1-19(2,3)25-17(23)22-11-9-13-7-8-15(20-4)16(14(13)10-12-22)26-18(24)21(5)6/h7-8H,9-12H2,1-3,5-6H3 |
| InChIKey | YJDAMFZMRSUJES-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 54.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|