C33H35ClF2N4O5S — CID 170033441
tert-butyl 9-[6-carbamoyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-fluorophenyl]-8-chloro-7-fluoro-10a-phenyl-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate (PubChem CID 170033441) has the molecular formula C33H35ClF2N4O5S and a molecular weight of 673.18 g/mol. Its IUPAC name is tert-butyl 9-[6-carbamoyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-fluorophenyl]-8-chloro-7-fluoro-10a-phenyl-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate.
| Compound Name | tert-butyl 9-[6-carbamoyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-fluorophenyl]-8-chloro-7-fluoro-10a-phenyl-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate |
|---|---|
| PubChem CID | 170033441 |
| Molecular Formula | C33H35ClF2N4O5S |
| Molecular Weight | 673.18 g/mol |
| Exact Mass | 672.20 |
| IUPAC Name | tert-butyl 9-[6-carbamoyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-fluorophenyl]-8-chloro-7-fluoro-10a-phenyl-1,3,4,10-tetrahydropyrazino[1,2-a]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3cc(F)c(Cl)c(-c4c(C(N)=O)ccc(N5CCS(=O)(=O)CC5)c4F)c3CC2(c2ccccc2)C1 |
| InChI | InChI=1S/C33H35ClF2N4O5S/c1-32(2,3)45-31(42)39-11-12-40-25-17-23(35)28(34)26(22(25)18-33(40,19-39)20-7-5-4-6-8-20)27-21(30(37)41)9-10-24(29(27)36)38-13-15-46(43,44)16-14-38/h4-10,17H,11-16,18-19H2,1-3H3,(H2,37,41) |
| InChIKey | NZBUETGETAZKDP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.18 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |