C24H29BClFN2O3 — CID 174051590
8-chloro-7-fluoro-10a-(3-methoxyphenyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,4,10-tetrahydro-1H-pyrazino[1,2-a]indole (PubChem CID 174051590) has the molecular formula C24H29BClFN2O3 and a molecular weight of 458.77 g/mol. Its IUPAC name is 8-chloro-7-fluoro-10a-(3-methoxyphenyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,4,10-tetrahydro-1H-pyrazino[1,2-a]indole.
| Compound Name | 8-chloro-7-fluoro-10a-(3-methoxyphenyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,4,10-tetrahydro-1H-pyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 174051590 |
| Molecular Formula | C24H29BClFN2O3 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 8-chloro-7-fluoro-10a-(3-methoxyphenyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,4,10-tetrahydro-1H-pyrazino[1,2-a]indole |
| SMILES | COc1cccc(C23CNCCN2c2cc(F)c(Cl)c(B4OC(C)(C)C(C)(C)O4)c2C3)c1 |
| InChI | InChI=1S/C24H29BClFN2O3/c1-22(2)23(3,4)32-25(31-22)20-17-13-24(15-7-6-8-16(11-15)30-5)14-28-9-10-29(24)19(17)12-18(27)21(20)26/h6-8,11-12,28H,9-10,13-14H2,1-5H3 |
| InChIKey | WHDPIOBIHWRGPT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|