C23H36BN3O5 — CID 140760057
tert-butyl 4-[2-acetamido-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate (PubChem CID 140760057) has the molecular formula C23H36BN3O5 and a molecular weight of 445.37 g/mol. Its IUPAC name is tert-butyl 4-[2-acetamido-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-acetamido-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140760057 |
| Molecular Formula | C23H36BN3O5 |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | tert-butyl 4-[2-acetamido-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)cc1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H36BN3O5/c1-16(28)25-18-10-9-17(24-31-22(5,6)23(7,8)32-24)15-19(18)26-11-13-27(14-12-26)20(29)30-21(2,3)4/h9-10,15H,11-14H2,1-8H3,(H,25,28) |
| InChIKey | ZEGHJYASDYJPNX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|