C27H44BN3O4 — CID 140760059
tert-butyl N-[2-(4-cyclohexylpiperazin-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (PubChem CID 140760059) has the molecular formula C27H44BN3O4 and a molecular weight of 485.48 g/mol. Its IUPAC name is tert-butyl N-[2-(4-cyclohexylpiperazin-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-cyclohexylpiperazin-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 140760059 |
| Molecular Formula | C27H44BN3O4 |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | tert-butyl N-[2-(4-cyclohexylpiperazin-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)cc1N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C27H44BN3O4/c1-25(2,3)33-24(32)29-22-14-13-20(28-34-26(4,5)27(6,7)35-28)19-23(22)31-17-15-30(16-18-31)21-11-9-8-10-12-21/h13-14,19,21H,8-12,15-18H2,1-7H3,(H,29,32) |
| InChIKey | ZBCLALOEEBFUDB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|