C21H30BFN2O5 — CID 91048658
tert-butyl N-[(3S)-1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxopyrrolidin-3-yl]carbamate (PubChem CID 91048658) has the molecular formula C21H30BFN2O5 and a molecular weight of 420.29 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxopyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 91048658 |
| Molecular Formula | C21H30BFN2O5 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxopyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)C1=O |
| InChI | InChI=1S/C21H30BFN2O5/c1-19(2,3)28-18(27)24-15-10-11-25(17(15)26)16-9-8-13(12-14(16)23)22-29-20(4,5)21(6,7)30-22/h8-9,12,15H,10-11H2,1-7H3,(H,24,27)/t15-/m0/s1 |
| InChIKey | NFXGSBIDGGQQCH-HNNXBMFYSA-N |
| XLogP | 2.75 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|