C27H36BNO5 — CID 101457178
tert-butyl N-[2-[(Z)-2-hydroxy-4-phenylbut-1-enyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (PubChem CID 101457178) has the molecular formula C27H36BNO5 and a molecular weight of 465.40 g/mol. Its IUPAC name is tert-butyl N-[2-[(Z)-2-hydroxy-4-phenylbut-1-enyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(Z)-2-hydroxy-4-phenylbut-1-enyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 101457178 |
| Molecular Formula | C27H36BNO5 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | tert-butyl N-[2-[(Z)-2-hydroxy-4-phenylbut-1-enyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)cc1/C=C(\O)CCc1ccccc1 |
| InChI | InChI=1S/C27H36BNO5/c1-25(2,3)32-24(31)29-23-16-14-21(28-33-26(4,5)27(6,7)34-28)17-20(23)18-22(30)15-13-19-11-9-8-10-12-19/h8-12,14,16-18,30H,13,15H2,1-7H3,(H,29,31)/b22-18- |
| InChIKey | WYYFFZOYQKQLDN-PYCFMQQDSA-N |
| XLogP | 5.86 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|