C24H32BNO5 — CID 59418728
tert-butyl N-[3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]carbamate (PubChem CID 59418728) has the molecular formula C24H32BNO5 and a molecular weight of 425.33 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 59418728 |
| Molecular Formula | C24H32BNO5 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | tert-butyl N-[3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(OCc2cccc(B3OC(C)(C)C(C)(C)O3)c2)c1 |
| InChI | InChI=1S/C24H32BNO5/c1-22(2,3)29-21(27)26-19-12-9-13-20(15-19)28-16-17-10-8-11-18(14-17)25-30-23(4,5)24(6,7)31-25/h8-15H,16H2,1-7H3,(H,26,27) |
| InChIKey | WUAXBXJFUDYXJI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|