C20H24BNO5 — CID 123676254
[3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]carbamic acid (PubChem CID 123676254) has the molecular formula C20H24BNO5 and a molecular weight of 369.23 g/mol. Its IUPAC name is [3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]carbamic acid.
| Compound Name | [3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]carbamic acid |
|---|---|
| PubChem CID | 123676254 |
| Molecular Formula | C20H24BNO5 |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]carbamic acid |
| SMILES | CC1(C)OB(c2cccc(COc3cccc(NC(=O)O)c3)c2)OC1(C)C |
| InChI | InChI=1S/C20H24BNO5/c1-19(2)20(3,4)27-21(26-19)15-8-5-7-14(11-15)13-25-17-10-6-9-16(12-17)22-18(23)24/h5-12,22H,13H2,1-4H3,(H,23,24) |
| InChIKey | DVAJGVMWMBJONY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|