C24H27BO5 — CID 140789838
(1S,1aS,6aR)-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid (PubChem CID 140789838) has the molecular formula C24H27BO5 and a molecular weight of 406.29 g/mol. Its IUPAC name is (1S,1aS,6aR)-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid.
| Compound Name | (1S,1aS,6aR)-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
|---|---|
| PubChem CID | 140789838 |
| Molecular Formula | C24H27BO5 |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (1S,1aS,6aR)-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
| SMILES | CC1(C)OB(c2cccc(COc3ccc4c(c3)C[C@H]3[C@H](C(=O)O)[C@@H]43)c2)OC1(C)C |
| InChI | InChI=1S/C24H27BO5/c1-23(2)24(3,4)30-25(29-23)16-7-5-6-14(10-16)13-28-17-8-9-18-15(11-17)12-19-20(18)21(19)22(26)27/h5-11,19-21H,12-13H2,1-4H3,(H,26,27)/t19-,20+,21+/m1/s1 |
| InChIKey | KVQQDOSHSDNEAZ-HKBOAZHASA-N |
| XLogP | 3.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|