C25H29BO5 — CID 162346139
4-[[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid (PubChem CID 162346139) has the molecular formula C25H29BO5 and a molecular weight of 420.31 g/mol. Its IUPAC name is 4-[[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid.
| Compound Name | 4-[[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
|---|---|
| PubChem CID | 162346139 |
| Molecular Formula | C25H29BO5 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-[[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
| SMILES | Cc1ccc(COc2ccc3c(c2)CC2C(C(=O)O)C32)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H29BO5/c1-14-6-7-15(10-20(14)26-30-24(2,3)25(4,5)31-26)13-29-17-8-9-18-16(11-17)12-19-21(18)22(19)23(27)28/h6-11,19,21-22H,12-13H2,1-5H3,(H,27,28) |
| InChIKey | KWWRNCDWCLQHHU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|