C29H29NO3 — CID 126705221
(2S,3S,4R)-8-[[7-methyl-8-(2-methylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid (PubChem CID 126705221) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is (2S,3S,4R)-8-[[7-methyl-8-(2-methylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid.
| Compound Name | (2S,3S,4R)-8-[[7-methyl-8-(2-methylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 126705221 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (2S,3S,4R)-8-[[7-methyl-8-(2-methylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
| SMILES | Cc1ccccc1C1c2cc(COc3cc4c(cn3)[C@H]3[C@@H](C4)[C@@H]3C(=O)O)ccc2CCC1C |
| InChI | InChI=1S/C29H29NO3/c1-16-5-3-4-6-21(16)26-17(2)7-9-19-10-8-18(11-22(19)26)15-33-25-13-20-12-23-27(24(20)14-30-25)28(23)29(31)32/h3-6,8,10-11,13-14,17,23,26-28H,7,9,12,15H2,1-2H3,(H,31,32)/t17?,23-,26?,27-,28+/m1/s1 |
| InChIKey | UZSKWZKDRZCOOI-CBMGLJQWSA-N |
| XLogP | 5.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |