C26H19F3N2O3 — CID 126689601
(2S,3S,4R)-8-[[1-[2-(trifluoromethyl)phenyl]indol-6-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid (PubChem CID 126689601) has the molecular formula C26H19F3N2O3 and a molecular weight of 464.44 g/mol. Its IUPAC name is (2S,3S,4R)-8-[[1-[2-(trifluoromethyl)phenyl]indol-6-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid.
| Compound Name | (2S,3S,4R)-8-[[1-[2-(trifluoromethyl)phenyl]indol-6-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 126689601 |
| Molecular Formula | C26H19F3N2O3 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (2S,3S,4R)-8-[[1-[2-(trifluoromethyl)phenyl]indol-6-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@@H]2Cc3cc(OCc4ccc5ccn(-c6ccccc6C(F)(F)F)c5c4)ncc3[C@@H]21 |
| InChI | InChI=1S/C26H19F3N2O3/c27-26(28,29)19-3-1-2-4-20(19)31-8-7-15-6-5-14(9-21(15)31)13-34-22-11-16-10-17-23(18(16)12-30-22)24(17)25(32)33/h1-9,11-12,17,23-24H,10,13H2,(H,32,33)/t17-,23-,24+/m1/s1 |
| InChIKey | KARMFSIUAXFNEP-VEYWIMSWSA-N |
| XLogP | 5.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |