C30H31NO3 — CID 118526450
ethyl (2S,3S,4R)-8-[(1,1-dimethyl-3-phenyl-2,3-dihydroinden-5-yl)methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate (PubChem CID 118526450) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is ethyl (2S,3S,4R)-8-[(1,1-dimethyl-3-phenyl-2,3-dihydroinden-5-yl)methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate.
| Compound Name | ethyl (2S,3S,4R)-8-[(1,1-dimethyl-3-phenyl-2,3-dihydroinden-5-yl)methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate |
|---|---|
| PubChem CID | 118526450 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | ethyl (2S,3S,4R)-8-[(1,1-dimethyl-3-phenyl-2,3-dihydroinden-5-yl)methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2Cc3cc(OCc4ccc5c(c4)C(c4ccccc4)CC5(C)C)ncc3[C@@H]21 |
| InChI | InChI=1S/C30H31NO3/c1-4-33-29(32)28-22-13-20-14-26(31-16-24(20)27(22)28)34-17-18-10-11-25-21(12-18)23(15-30(25,2)3)19-8-6-5-7-9-19/h5-12,14,16,22-23,27-28H,4,13,15,17H2,1-3H3/t22-,23?,27-,28+/m1/s1 |
| InChIKey | QPAHLMOFWGMOEE-MYJJVHJCSA-N |
| XLogP | 5.92 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |