C19H29NO3Si — CID 123210837
tert-butyl 8-(2-trimethylsilylethoxy)-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate (PubChem CID 123210837) has the molecular formula C19H29NO3Si and a molecular weight of 347.53 g/mol. Its IUPAC name is tert-butyl 8-(2-trimethylsilylethoxy)-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate.
| Compound Name | tert-butyl 8-(2-trimethylsilylethoxy)-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate |
|---|---|
| PubChem CID | 123210837 |
| Molecular Formula | C19H29NO3Si |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | tert-butyl 8-(2-trimethylsilylethoxy)-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C2Cc3cc(OCC[Si](C)(C)C)ncc3C21 |
| InChI | InChI=1S/C19H29NO3Si/c1-19(2,3)23-18(21)17-13-9-12-10-15(20-11-14(12)16(13)17)22-7-8-24(4,5)6/h10-11,13,16-17H,7-9H2,1-6H3 |
| InChIKey | KRAVSPSEIQILEA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|