C19H17BFNO3 — CID 123839830
CID 123839830 (PubChem CID 123839830) has the molecular formula C19H17BFNO3 and a molecular weight of 337.16 g/mol.
| Compound Name | CID 123839830 |
|---|---|
| PubChem CID | 123839830 |
| Molecular Formula | C19H17BFNO3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(F)c(COc2cc3c(cn2)[C@H]2[C@@H](C3)[C@@H]2C(=O)OCC)c1 |
| InChI | InChI=1S/C19H17BFNO3/c1-2-24-19(23)18-13-6-10-7-16(22-8-14(10)17(13)18)25-9-11-5-12(20)3-4-15(11)21/h3-5,7-8,13,17-18H,2,6,9H2,1H3/t13-,17-,18+/m1/s1 |
| InChIKey | NBKHJKNYGDDJTC-XWIAVFTESA-N |
| XLogP | 2.04 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|