C31H32FNO3 — CID 126705211
ethyl (2S,3S,4R)-8-[[6-fluoro-1,1-dimethyl-3-(2-methylphenyl)-2,3-dihydroinden-5-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate (PubChem CID 126705211) has the molecular formula C31H32FNO3 and a molecular weight of 485.60 g/mol. Its IUPAC name is ethyl (2S,3S,4R)-8-[[6-fluoro-1,1-dimethyl-3-(2-methylphenyl)-2,3-dihydroinden-5-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate.
| Compound Name | ethyl (2S,3S,4R)-8-[[6-fluoro-1,1-dimethyl-3-(2-methylphenyl)-2,3-dihydroinden-5-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate |
|---|---|
| PubChem CID | 126705211 |
| Molecular Formula | C31H32FNO3 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | ethyl (2S,3S,4R)-8-[[6-fluoro-1,1-dimethyl-3-(2-methylphenyl)-2,3-dihydroinden-5-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2Cc3cc(OCc4cc5c(cc4F)C(C)(C)CC5c4ccccc4C)ncc3[C@@H]21 |
| InChI | InChI=1S/C31H32FNO3/c1-5-35-30(34)29-22-10-18-12-27(33-15-24(18)28(22)29)36-16-19-11-21-23(20-9-7-6-8-17(20)2)14-31(3,4)25(21)13-26(19)32/h6-9,11-13,15,22-23,28-29H,5,10,14,16H2,1-4H3/t22-,23?,28-,29+/m1/s1 |
| InChIKey | HCLYWZCVLDCXBQ-WFAVOUNOSA-N |
| XLogP | 6.37 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |