C27H24FNO4 — CID 126705235
(2S,3S,4R)-8-[[6-fluoro-1-(2-methylphenyl)-3,4-dihydro-1H-isochromen-7-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid (PubChem CID 126705235) has the molecular formula C27H24FNO4 and a molecular weight of 445.49 g/mol. Its IUPAC name is (2S,3S,4R)-8-[[6-fluoro-1-(2-methylphenyl)-3,4-dihydro-1H-isochromen-7-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid.
| Compound Name | (2S,3S,4R)-8-[[6-fluoro-1-(2-methylphenyl)-3,4-dihydro-1H-isochromen-7-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 126705235 |
| Molecular Formula | C27H24FNO4 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (2S,3S,4R)-8-[[6-fluoro-1-(2-methylphenyl)-3,4-dihydro-1H-isochromen-7-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
| SMILES | Cc1ccccc1C1OCCc2cc(F)c(COc3cc4c(cn3)[C@H]3[C@@H](C4)[C@@H]3C(=O)O)cc21 |
| InChI | InChI=1S/C27H24FNO4/c1-14-4-2-3-5-18(14)26-19-9-17(22(28)10-15(19)6-7-32-26)13-33-23-11-16-8-20-24(21(16)12-29-23)25(20)27(30)31/h2-5,9-12,20,24-26H,6-8,13H2,1H3,(H,30,31)/t20-,24-,25+,26?/m1/s1 |
| InChIKey | USTXSRXFSKZTMM-SLPRKMDESA-N |
| XLogP | 4.74 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |