C28H28FNO6 — CID 73051871
(2S,3S,4R)-8-[[5-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]-2-fluorophenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid (PubChem CID 73051871) has the molecular formula C28H28FNO6 and a molecular weight of 493.53 g/mol. Its IUPAC name is (2S,3S,4R)-8-[[5-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]-2-fluorophenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid.
| Compound Name | (2S,3S,4R)-8-[[5-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]-2-fluorophenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 73051871 |
| Molecular Formula | C28H28FNO6 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (2S,3S,4R)-8-[[5-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]-2-fluorophenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
| SMILES | Cc1cc(OCC(O)CO)cc(C)c1-c1ccc(F)c(COc2cc3c(cn2)[C@H]2[C@@H](C3)[C@@H]2C(=O)O)c1 |
| InChI | InChI=1S/C28H28FNO6/c1-14-5-20(35-13-19(32)11-31)6-15(2)25(14)16-3-4-23(29)18(7-16)12-36-24-9-17-8-21-26(22(17)10-30-24)27(21)28(33)34/h3-7,9-10,19,21,26-27,31-32H,8,11-13H2,1-2H3,(H,33,34)/t19?,21-,26-,27+/m1/s1 |
| InChIKey | DQBJVOJHQIXCML-ZVQKPCOOSA-N |
| XLogP | 3.79 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |