C30H31F2NO6 — CID 144825738
(2S)-4-[4-[2,4-difluoro-5-[[(2S,3S,4R)-3-[(2R)-3-hydroxyoxiran-2-yl]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]oxymethyl]phenyl]-3,5-dimethylphenoxy]butane-1,2-diol (PubChem CID 144825738) has the molecular formula C30H31F2NO6 and a molecular weight of 539.58 g/mol. Its IUPAC name is (2S)-4-[4-[2,4-difluoro-5-[[(2S,3S,4R)-3-[(2R)-3-hydroxyoxiran-2-yl]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]oxymethyl]phenyl]-3,5-dimethylphenoxy]butane-1,2-diol.
| Compound Name | (2S)-4-[4-[2,4-difluoro-5-[[(2S,3S,4R)-3-[(2R)-3-hydroxyoxiran-2-yl]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]oxymethyl]phenyl]-3,5-dimethylphenoxy]butane-1,2-diol |
|---|---|
| PubChem CID | 144825738 |
| Molecular Formula | C30H31F2NO6 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (2S)-4-[4-[2,4-difluoro-5-[[(2S,3S,4R)-3-[(2R)-3-hydroxyoxiran-2-yl]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]oxymethyl]phenyl]-3,5-dimethylphenoxy]butane-1,2-diol |
| SMILES | Cc1cc(OCC[C@H](O)CO)cc(C)c1-c1cc(COc2cc3c(cn2)[C@H]2[C@@H](C3)[C@@H]2[C@H]2OC2O)c(F)cc1F |
| InChI | InChI=1S/C30H31F2NO6/c1-14-5-19(37-4-3-18(35)12-34)6-15(2)26(14)20-8-17(23(31)10-24(20)32)13-38-25-9-16-7-21-27(22(16)11-33-25)28(21)29-30(36)39-29/h5-6,8-11,18,21,27-30,34-36H,3-4,7,12-13H2,1-2H3/t18-,21+,27+,28-,29+,30?/m0/s1 |
| InChIKey | XDOFDYHLQZIZLL-DURXEOIZSA-N |
| XLogP | 3.95 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|