C31H31F2NO5S — CID 159229328
1-[(2S,3S,4R)-8-[[5-[2,6-dimethyl-4-(3-methylsulfonylcyclobutyl)oxyphenyl]-2,4-difluorophenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-3-yl]ethanone (PubChem CID 159229328) has the molecular formula C31H31F2NO5S and a molecular weight of 567.65 g/mol. Its IUPAC name is 1-[(2S,3S,4R)-8-[[5-[2,6-dimethyl-4-(3-methylsulfonylcyclobutyl)oxyphenyl]-2,4-difluorophenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-3-yl]ethanone.
| Compound Name | 1-[(2S,3S,4R)-8-[[5-[2,6-dimethyl-4-(3-methylsulfonylcyclobutyl)oxyphenyl]-2,4-difluorophenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-3-yl]ethanone |
|---|---|
| PubChem CID | 159229328 |
| Molecular Formula | C31H31F2NO5S |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 1-[(2S,3S,4R)-8-[[5-[2,6-dimethyl-4-(3-methylsulfonylcyclobutyl)oxyphenyl]-2,4-difluorophenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-3-yl]ethanone |
| SMILES | CC(=O)[C@H]1[C@@H]2Cc3cc(OCc4cc(-c5c(C)cc(OC6CC(S(C)(=O)=O)C6)cc5C)c(F)cc4F)ncc3[C@@H]21 |
| InChI | InChI=1S/C31H31F2NO5S/c1-15-5-20(39-21-10-22(11-21)40(4,36)37)6-16(2)29(15)23-8-19(26(32)12-27(23)33)14-38-28-9-18-7-24-30(17(3)35)31(24)25(18)13-34-28/h5-6,8-9,12-13,21-22,24,30-31H,7,10-11,14H2,1-4H3/t21?,22?,24-,30-,31+/m0/s1 |
| InChIKey | XSHRPTYVUPRGLH-UFEHRPGGSA-N |
| XLogP | 5.65 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |