C32H35F2NO6 — CID 118086756
(2R)-2-[3-[4-[5-[[(2S,3S,4R)-3-(dihydroxymethyl)-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]oxymethyl]-2,4-difluorophenyl]-3,5-dimethylphenoxy]cyclobutyl]propane-1,2-diol (PubChem CID 118086756) has the molecular formula C32H35F2NO6 and a molecular weight of 567.63 g/mol. Its IUPAC name is (2R)-2-[3-[4-[5-[[(2S,3S,4R)-3-(dihydroxymethyl)-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]oxymethyl]-2,4-difluorophenyl]-3,5-dimethylphenoxy]cyclobutyl]propane-1,2-diol.
| Compound Name | (2R)-2-[3-[4-[5-[[(2S,3S,4R)-3-(dihydroxymethyl)-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]oxymethyl]-2,4-difluorophenyl]-3,5-dimethylphenoxy]cyclobutyl]propane-1,2-diol |
|---|---|
| PubChem CID | 118086756 |
| Molecular Formula | C32H35F2NO6 |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | (2R)-2-[3-[4-[5-[[(2S,3S,4R)-3-(dihydroxymethyl)-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]oxymethyl]-2,4-difluorophenyl]-3,5-dimethylphenoxy]cyclobutyl]propane-1,2-diol |
| SMILES | Cc1cc(OC2CC([C@@](C)(O)CO)C2)cc(C)c1-c1cc(COc2cc3c(cn2)[C@H]2[C@@H](C3)[C@@H]2C(O)O)c(F)cc1F |
| InChI | InChI=1S/C32H35F2NO6/c1-15-4-20(41-21-9-19(10-21)32(3,39)14-36)5-16(2)28(15)22-7-18(25(33)11-26(22)34)13-40-27-8-17-6-23-29(24(17)12-35-27)30(23)31(37)38/h4-5,7-8,11-12,19,21,23,29-31,36-39H,6,9-10,13-14H2,1-3H3/t19?,21?,23-,29-,30+,32+/m1/s1 |
| InChIKey | MIYHPLVTTRPGCN-ZVKMPFKISA-N |
| XLogP | 4.32 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|