C32H32N2O3 — CID 159294613
1-[(2S,3S,4R)-8-[[3-[4-(3-isocyano-3-methylcyclobutyl)oxy-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-3-yl]ethanone (PubChem CID 159294613) has the molecular formula C32H32N2O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-[(2S,3S,4R)-8-[[3-[4-(3-isocyano-3-methylcyclobutyl)oxy-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-3-yl]ethanone.
| Compound Name | 1-[(2S,3S,4R)-8-[[3-[4-(3-isocyano-3-methylcyclobutyl)oxy-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-3-yl]ethanone |
|---|---|
| PubChem CID | 159294613 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 1-[(2S,3S,4R)-8-[[3-[4-(3-isocyano-3-methylcyclobutyl)oxy-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-3-yl]ethanone |
| SMILES | [C-]#[N+]C1(C)CC(Oc2cc(C)c(-c3cccc(COc4cc5c(cn4)[C@H]4[C@@H](C5)[C@@H]4C(C)=O)c3)c(C)c2)C1 |
| InChI | InChI=1S/C32H32N2O3/c1-18-9-24(37-25-14-32(4,15-25)33-5)10-19(2)29(18)22-8-6-7-21(11-22)17-36-28-13-23-12-26-30(20(3)35)31(26)27(23)16-34-28/h6-11,13,16,25-26,30-31H,12,14-15,17H2,1-4H3/t25?,26-,30-,31+,32?/m0/s1 |
| InChIKey | SFWFCYVLFFNTBM-HRVHTHECSA-N |
| XLogP | 6.64 |
| TPSA | 52.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|