C33H41N2O9S+2 — CID 132579143
CID 132579143 (PubChem CID 132579143) has the molecular formula C33H41N2O9S+2 and a molecular weight of 641.76 g/mol.
| Compound Name | CID 132579143 |
|---|---|
| PubChem CID | 132579143 |
| Molecular Formula | C33H41N2O9S+2 |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 641.25 |
| IUPAC Name | — |
| SMILES | Cc1cc(OCCC[S+](C)([O])=O)cc(C)c1-c1cccc(COc2cc3c(cn2)[C@H]2[C@@H](C3)[C@@H]2C(=O)O[NH2+]C(CO)(CO)CO)c1 |
| InChI | InChI=1S/C33H40N2O9S/c1-20-10-25(42-8-5-9-45(3,40)41)11-21(2)29(20)23-7-4-6-22(12-23)16-43-28-14-24-13-26-30(27(24)15-34-28)31(26)32(39)44-35-33(17-36,18-37)19-38/h4,6-7,10-12,14-15,26,30-31,35-38H,5,8-9,13,16-19H2,1-3H3/q+1/p+1/t26-,30-,31+/m1/s1 |
| InChIKey | LGBGHQREHQGBIC-KPNCYPGSSA-O |
| XLogP | 1.81 |
| TPSA | 171.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|